C49H41NO — CID 145280401
(1E,3E,5Z,7E,9E,11Z)-10-[3-[(3Z,5Z)-2-methylidene-7H-1-benzoxonin-11-yl]phenyl]-4-phenyl-12-(4-phenylphenyl)dodeca-1,3,5,7,9,11-hexaen-1-amine (PubChem CID 145280401) has the molecular formula C49H41NO and a molecular weight of 659.87 g/mol. Its IUPAC name is (1E,3E,5Z,7E,9E,11Z)-10-[3-[(3Z,5Z)-2-methylidene-7H-1-benzoxonin-11-yl]phenyl]-4-phenyl-12-(4-phenylphenyl)dodeca-1,3,5,7,9,11-hexaen-1-amine.
| Compound Name | (1E,3E,5Z,7E,9E,11Z)-10-[3-[(3Z,5Z)-2-methylidene-7H-1-benzoxonin-11-yl]phenyl]-4-phenyl-12-(4-phenylphenyl)dodeca-1,3,5,7,9,11-hexaen-1-amine |
|---|---|
| PubChem CID | 145280401 |
| Molecular Formula | C49H41NO |
| Molecular Weight | 659.87 g/mol |
| Exact Mass | 659.32 |
| IUPAC Name | (1E,3E,5Z,7E,9E,11Z)-10-[3-[(3Z,5Z)-2-methylidene-7H-1-benzoxonin-11-yl]phenyl]-4-phenyl-12-(4-phenylphenyl)dodeca-1,3,5,7,9,11-hexaen-1-amine |
| SMILES | C=C1/C=C\C=C/Cc2cccc(-c3cccc(C(/C=C\c4ccc(-c5ccccc5)cc4)=C/C=C/C=C\C(=C/C=C/N)c4ccccc4)c3)c2O1 |
| InChI | InChI=1S/C49H41NO/c1-38-17-6-2-13-24-45-25-15-29-48(49(45)51-38)47-27-14-26-46(37-47)43(33-30-39-31-34-44(35-32-39)41-20-9-4-10-21-41)23-12-5-11-22-42(28-16-36-50)40-18-7-3-8-19-40/h2-23,25-37H,1,24,50H2/b12-5+,13-2-,17-6-,22-11-,33-30-,36-16+,42-28+,43-23+ |
| InChIKey | DLNYDGADVHMKTK-YOFNNZAHSA-N |
| XLogP | 12.35 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.87 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|