C43H41NO — CID 142622077
1-[2-[(3E,5E,7Z)-6-methyl-2-[4-[(3Z,5Z)-2-methylidene-7H-1-benzoxonin-11-yl]phenyl]nona-1,3,5,7-tetraen-4-yl]phenyl]-2-phenylethanamine (PubChem CID 142622077) has the molecular formula C43H41NO and a molecular weight of 587.81 g/mol. Its IUPAC name is 1-[2-[(3E,5E,7Z)-6-methyl-2-[4-[(3Z,5Z)-2-methylidene-7H-1-benzoxonin-11-yl]phenyl]nona-1,3,5,7-tetraen-4-yl]phenyl]-2-phenylethanamine.
| Compound Name | 1-[2-[(3E,5E,7Z)-6-methyl-2-[4-[(3Z,5Z)-2-methylidene-7H-1-benzoxonin-11-yl]phenyl]nona-1,3,5,7-tetraen-4-yl]phenyl]-2-phenylethanamine |
|---|---|
| PubChem CID | 142622077 |
| Molecular Formula | C43H41NO |
| Molecular Weight | 587.81 g/mol |
| Exact Mass | 587.32 |
| IUPAC Name | 1-[2-[(3E,5E,7Z)-6-methyl-2-[4-[(3Z,5Z)-2-methylidene-7H-1-benzoxonin-11-yl]phenyl]nona-1,3,5,7-tetraen-4-yl]phenyl]-2-phenylethanamine |
| SMILES | C=C1/C=C\C=C/Cc2cccc(-c3ccc(C(=C)/C=C(\C=C(C)\C=C/C)c4ccccc4C(N)Cc4ccccc4)cc3)c2O1 |
| InChI | InChI=1S/C43H41NO/c1-5-15-31(2)28-38(39-21-12-13-22-41(39)42(44)30-34-17-9-7-10-18-34)29-32(3)35-24-26-36(27-25-35)40-23-14-20-37-19-11-6-8-16-33(4)45-43(37)40/h5-18,20-29,42H,3-4,19,30,44H2,1-2H3/b11-6-,15-5-,16-8-,31-28+,38-29+ |
| InChIKey | CKKZEHDCKJJZCP-SSVFGVFTSA-N |
| XLogP | 10.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.81 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|