C49H44 — CID 144896733
1-[2-[2-[(3E,5E)-6-cyclohexa-2,4-dien-1-yl-2-phenylhepta-1,3,5-trien-4-yl]phenyl]phenyl]-4-[(1Z,3Z)-1-(2-methylphenyl)penta-1,3-dien-2-yl]benzene (PubChem CID 144896733) has the molecular formula C49H44 and a molecular weight of 632.89 g/mol. Its IUPAC name is 1-[2-[2-[(3E,5E)-6-cyclohexa-2,4-dien-1-yl-2-phenylhepta-1,3,5-trien-4-yl]phenyl]phenyl]-4-[(1Z,3Z)-1-(2-methylphenyl)penta-1,3-dien-2-yl]benzene.
| Compound Name | 1-[2-[2-[(3E,5E)-6-cyclohexa-2,4-dien-1-yl-2-phenylhepta-1,3,5-trien-4-yl]phenyl]phenyl]-4-[(1Z,3Z)-1-(2-methylphenyl)penta-1,3-dien-2-yl]benzene |
|---|---|
| PubChem CID | 144896733 |
| Molecular Formula | C49H44 |
| Molecular Weight | 632.89 g/mol |
| Exact Mass | 632.34 |
| IUPAC Name | 1-[2-[2-[(3E,5E)-6-cyclohexa-2,4-dien-1-yl-2-phenylhepta-1,3,5-trien-4-yl]phenyl]phenyl]-4-[(1Z,3Z)-1-(2-methylphenyl)penta-1,3-dien-2-yl]benzene |
| SMILES | C=C(/C=C(\C=C(/C)C1C=CC=CC1)c1ccccc1-c1ccccc1-c1ccc(C(/C=C\C)=C\c2ccccc2C)cc1)c1ccccc1 |
| InChI | InChI=1S/C49H44/c1-5-18-44(35-43-24-13-12-19-36(43)2)41-29-31-42(32-30-41)46-25-14-16-27-48(46)49-28-17-15-26-47(49)45(33-37(3)39-20-8-6-9-21-39)34-38(4)40-22-10-7-11-23-40/h5-22,24-35,40H,3,23H2,1-2,4H3/b18-5-,38-34+,44-35-,45-33+ |
| InChIKey | YRNJIJRFXBZQNJ-YJEKWYHESA-N |
| XLogP | 13.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.89 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|