C18H23N — CID 142359042
aniline;5-[(2E,4Z)-hexa-2,4-dien-3-yl]cyclohexa-1,3-diene (PubChem CID 142359042) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is aniline;5-[(2E,4Z)-hexa-2,4-dien-3-yl]cyclohexa-1,3-diene.
| Compound Name | aniline;5-[(2E,4Z)-hexa-2,4-dien-3-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142359042 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | aniline;5-[(2E,4Z)-hexa-2,4-dien-3-yl]cyclohexa-1,3-diene |
| SMILES | C/C=C\C(=C/C)C1C=CC=CC1.Nc1ccccc1 |
| InChI | InChI=1S/C12H16.C6H7N/c1-3-8-11(4-2)12-9-6-5-7-10-12;7-6-4-2-1-3-5-6/h3-9,12H,10H2,1-2H3;1-5H,7H2/b8-3-,11-4+; |
| InChIKey | HUAHJEDGMSIXFL-VJVHXOJGSA-N |
| XLogP | 4.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|