C21H21N — CID 166885812
N-(2-benzylphenyl)-1-cyclohexa-2,4-dien-1-ylethanimine (PubChem CID 166885812) has the molecular formula C21H21N and a molecular weight of 287.41 g/mol. Its IUPAC name is N-(2-benzylphenyl)-1-cyclohexa-2,4-dien-1-ylethanimine.
| Compound Name | N-(2-benzylphenyl)-1-cyclohexa-2,4-dien-1-ylethanimine |
|---|---|
| PubChem CID | 166885812 |
| Molecular Formula | C21H21N |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-(2-benzylphenyl)-1-cyclohexa-2,4-dien-1-ylethanimine |
| SMILES | C/C(=N\c1ccccc1Cc1ccccc1)C1C=CC=CC1 |
| InChI | InChI=1S/C21H21N/c1-17(19-12-6-3-7-13-19)22-21-15-9-8-14-20(21)16-18-10-4-2-5-11-18/h2-12,14-15,19H,13,16H2,1H3/b22-17+ |
| InChIKey | YRHDBFBJTDBRMZ-OQKWZONESA-N |
| XLogP | 5.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|