C18H17Cl2N3O — CID 145427469
4-[[3-(2-aminoethyl)-1-(2,4-dichlorophenyl)pyrazol-5-yl]methyl]phenol (PubChem CID 145427469) has the molecular formula C18H17Cl2N3O and a molecular weight of 362.26 g/mol. Its IUPAC name is 4-[[3-(2-aminoethyl)-1-(2,4-dichlorophenyl)pyrazol-5-yl]methyl]phenol.
| Compound Name | 4-[[3-(2-aminoethyl)-1-(2,4-dichlorophenyl)pyrazol-5-yl]methyl]phenol |
|---|---|
| PubChem CID | 145427469 |
| Molecular Formula | C18H17Cl2N3O |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 4-[[3-(2-aminoethyl)-1-(2,4-dichlorophenyl)pyrazol-5-yl]methyl]phenol |
| SMILES | NCCc1cc(Cc2ccc(O)cc2)n(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C18H17Cl2N3O/c19-13-3-6-18(17(20)10-13)23-15(11-14(22-23)7-8-21)9-12-1-4-16(24)5-2-12/h1-6,10-11,24H,7-9,21H2 |
| InChIKey | ALYYEPBMADURSR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |