C19H18 — CID 145429604
pentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,8,13,18-hexaene (PubChem CID 145429604) has the molecular formula C19H18 and a molecular weight of 246.35 g/mol. Its IUPAC name is pentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,8,13,18-hexaene.
| Compound Name | pentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,8,13,18-hexaene |
|---|---|
| PubChem CID | 145429604 |
| Molecular Formula | C19H18 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | pentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,8,13,18-hexaene |
| SMILES | c1c2c(cc3c1Cc1cc4c(cc1-3)CCC4)CCC2 |
| InChI | InChI=1S/C19H18/c1-3-12-7-16-9-17-8-13-4-2-6-15(13)11-19(17)18(16)10-14(12)5-1/h7-8,10-11H,1-6,9H2 |
| InChIKey | UCMPBQKKRFZKLB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |