C11H10OS — CID 82374186
3,5,6,7-tetrahydrocyclopenta[f][1]benzothiol-2-one (PubChem CID 82374186) has the molecular formula C11H10OS and a molecular weight of 190.27 g/mol. Its IUPAC name is 3,5,6,7-tetrahydrocyclopenta[f][1]benzothiol-2-one.
| Compound Name | 3,5,6,7-tetrahydrocyclopenta[f][1]benzothiol-2-one |
|---|---|
| PubChem CID | 82374186 |
| Molecular Formula | C11H10OS |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 3,5,6,7-tetrahydrocyclopenta[f][1]benzothiol-2-one |
| SMILES | O=C1Cc2cc3c(cc2S1)CCC3 |
| InChI | InChI=1S/C11H10OS/c12-11-6-9-4-7-2-1-3-8(7)5-10(9)13-11/h4-5H,1-3,6H2 |
| InChIKey | YZXATRNUZCUDQN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|