C27H32BrNO2 — CID 145429992
(4Z,6E,8E)-5-[4-[2-(aziridin-1-yl)ethoxy]phenyl]-9-bromo-6-methyl-4-phenyldeca-4,6,8-trien-1-ol (PubChem CID 145429992) has the molecular formula C27H32BrNO2 and a molecular weight of 482.46 g/mol. Its IUPAC name is (4Z,6E,8E)-5-[4-[2-(aziridin-1-yl)ethoxy]phenyl]-9-bromo-6-methyl-4-phenyldeca-4,6,8-trien-1-ol.
| Compound Name | (4Z,6E,8E)-5-[4-[2-(aziridin-1-yl)ethoxy]phenyl]-9-bromo-6-methyl-4-phenyldeca-4,6,8-trien-1-ol |
|---|---|
| PubChem CID | 145429992 |
| Molecular Formula | C27H32BrNO2 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | (4Z,6E,8E)-5-[4-[2-(aziridin-1-yl)ethoxy]phenyl]-9-bromo-6-methyl-4-phenyldeca-4,6,8-trien-1-ol |
| SMILES | C/C(Br)=C\C=C(C)\C(=C(/CCCO)c1ccccc1)c1ccc(OCCN2CC2)cc1 |
| InChI | InChI=1S/C27H32BrNO2/c1-21(10-11-22(2)28)27(26(9-6-19-30)23-7-4-3-5-8-23)24-12-14-25(15-13-24)31-20-18-29-16-17-29/h3-5,7-8,10-15,30H,6,9,16-20H2,1-2H3/b21-10+,22-11+,27-26- |
| InChIKey | UYXVGULCLXAPHE-FXHWXHEBSA-N |
| XLogP | 6.31 |
| TPSA | 32.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|