C12H18N+ — CID 145430184
1,1-dimethyl-3-(4-methylphenyl)azetidin-1-ium (PubChem CID 145430184) has the molecular formula C12H18N+ and a molecular weight of 176.28 g/mol. Its IUPAC name is 1,1-dimethyl-3-(4-methylphenyl)azetidin-1-ium.
| Compound Name | 1,1-dimethyl-3-(4-methylphenyl)azetidin-1-ium |
|---|---|
| PubChem CID | 145430184 |
| Molecular Formula | C12H18N+ |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | 1,1-dimethyl-3-(4-methylphenyl)azetidin-1-ium |
| SMILES | Cc1ccc(C2C[N+](C)(C)C2)cc1 |
| InChI | InChI=1S/C12H18N/c1-10-4-6-11(7-5-10)12-8-13(2,3)9-12/h4-7,12H,8-9H2,1-3H3/q+1 |
| InChIKey | OCKDBQVMEKTCKG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|