C31H31N7O — CID 145431249
(1S)-3-[[5-(3-cyanophenyl)-2-(3-methylanilino)pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carbonitrile;pyrrolidine-1-carbaldehyde (PubChem CID 145431249) has the molecular formula C31H31N7O and a molecular weight of 517.64 g/mol. Its IUPAC name is (1S)-3-[[5-(3-cyanophenyl)-2-(3-methylanilino)pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carbonitrile;pyrrolidine-1-carbaldehyde.
| Compound Name | (1S)-3-[[5-(3-cyanophenyl)-2-(3-methylanilino)pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carbonitrile;pyrrolidine-1-carbaldehyde |
|---|---|
| PubChem CID | 145431249 |
| Molecular Formula | C31H31N7O |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | (1S)-3-[[5-(3-cyanophenyl)-2-(3-methylanilino)pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carbonitrile;pyrrolidine-1-carbaldehyde |
| SMILES | Cc1cccc(Nc2ncc(-c3cccc(C#N)c3)c(NC3C4C=C[C@H](C4)C3C#N)n2)c1.O=CN1CCCC1 |
| InChI | InChI=1S/C26H22N6.C5H9NO/c1-16-4-2-7-21(10-16)30-26-29-15-23(18-6-3-5-17(11-18)13-27)25(32-26)31-24-20-9-8-19(12-20)22(24)14-28;7-5-6-3-1-2-4-6/h2-11,15,19-20,22,24H,12H2,1H3,(H2,29,30,31,32);5H,1-4H2/t19-,20?,22?,24?;/m1./s1 |
| InChIKey | BNVRKQISQSVNDC-RKBZTNGZSA-N |
| XLogP | 5.43 |
| TPSA | 117.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|