C12H17BrN2 — CID 145431783
5-bromo-1,3-dimethyl-N-[(E)-pent-1-enyl]pyridin-2-imine (PubChem CID 145431783) has the molecular formula C12H17BrN2 and a molecular weight of 269.19 g/mol. Its IUPAC name is 5-bromo-1,3-dimethyl-N-[(E)-pent-1-enyl]pyridin-2-imine.
| Compound Name | 5-bromo-1,3-dimethyl-N-[(E)-pent-1-enyl]pyridin-2-imine |
|---|---|
| PubChem CID | 145431783 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 5-bromo-1,3-dimethyl-N-[(E)-pent-1-enyl]pyridin-2-imine |
| SMILES | CCC/C=C/N=c1\c(C)cc(Br)cn1C |
| InChI | InChI=1S/C12H17BrN2/c1-4-5-6-7-14-12-10(2)8-11(13)9-15(12)3/h6-9H,4-5H2,1-3H3/b7-6+,14-12+ |
| InChIKey | CWPHCAOWJWJHIQ-CKRYPDTRSA-N |
| XLogP | 3.31 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |