C19H31N — CID 145432379
4-[(3E,5E)-4,6,7-trimethyl-5-propan-2-ylocta-1,3,5,7-tetraen-2-yl]piperidine (PubChem CID 145432379) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is 4-[(3E,5E)-4,6,7-trimethyl-5-propan-2-ylocta-1,3,5,7-tetraen-2-yl]piperidine.
| Compound Name | 4-[(3E,5E)-4,6,7-trimethyl-5-propan-2-ylocta-1,3,5,7-tetraen-2-yl]piperidine |
|---|---|
| PubChem CID | 145432379 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 4-[(3E,5E)-4,6,7-trimethyl-5-propan-2-ylocta-1,3,5,7-tetraen-2-yl]piperidine |
| SMILES | C=C(C)/C(C)=C(C(/C)=C/C(=C)C1CCNCC1)\C(C)C |
| InChI | InChI=1S/C19H31N/c1-13(2)17(7)19(14(3)4)16(6)12-15(5)18-8-10-20-11-9-18/h12,14,18,20H,1,5,8-11H2,2-4,6-7H3/b16-12+,19-17+ |
| InChIKey | FUXWOHPIQZYRIP-KZDRZIDVSA-N |
| XLogP | 5.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|