C24H46N2 — CID 177364241
4-[(3E)-4,5-dimethylhexa-1,3,5-trien-2-yl]-1-(piperidin-4-ylmethyl)piperidine;ethane;propane (PubChem CID 177364241) has the molecular formula C24H46N2 and a molecular weight of 362.65 g/mol. Its IUPAC name is 4-[(3E)-4,5-dimethylhexa-1,3,5-trien-2-yl]-1-(piperidin-4-ylmethyl)piperidine;ethane;propane.
| Compound Name | 4-[(3E)-4,5-dimethylhexa-1,3,5-trien-2-yl]-1-(piperidin-4-ylmethyl)piperidine;ethane;propane |
|---|---|
| PubChem CID | 177364241 |
| Molecular Formula | C24H46N2 |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 362.37 |
| IUPAC Name | 4-[(3E)-4,5-dimethylhexa-1,3,5-trien-2-yl]-1-(piperidin-4-ylmethyl)piperidine;ethane;propane |
| SMILES | C=C(C)/C(C)=C/C(=C)C1CCN(CC2CCNCC2)CC1.CC.CCC |
| InChI | InChI=1S/C19H32N2.C3H8.C2H6/c1-15(2)16(3)13-17(4)19-7-11-21(12-8-19)14-18-5-9-20-10-6-18;1-3-2;1-2/h13,18-20H,1,4-12,14H2,2-3H3;3H2,1-2H3;1-2H3/b16-13+;; |
| InChIKey | XNPNMUBBIHYXCJ-YNHPUKFJSA-N |
| XLogP | 6.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|