C21H29ClN2O4 — CID 145432977
5-[[3-chloro-4-(4-cyclohexylbutoxy)phenyl]methyl]-6-hydroxy-1,3-diazinane-2,4-dione (PubChem CID 145432977) has the molecular formula C21H29ClN2O4 and a molecular weight of 408.93 g/mol. Its IUPAC name is 5-[[3-chloro-4-(4-cyclohexylbutoxy)phenyl]methyl]-6-hydroxy-1,3-diazinane-2,4-dione.
| Compound Name | 5-[[3-chloro-4-(4-cyclohexylbutoxy)phenyl]methyl]-6-hydroxy-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 145432977 |
| Molecular Formula | C21H29ClN2O4 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 5-[[3-chloro-4-(4-cyclohexylbutoxy)phenyl]methyl]-6-hydroxy-1,3-diazinane-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc(OCCCCC3CCCCC3)c(Cl)c2)C(O)N1 |
| InChI | InChI=1S/C21H29ClN2O4/c22-17-13-15(12-16-19(25)23-21(27)24-20(16)26)9-10-18(17)28-11-5-4-8-14-6-2-1-3-7-14/h9-10,13-14,16,19,25H,1-8,11-12H2,(H2,23,24,26,27) |
| InChIKey | RYTQSUUSRYBRHJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|