C22H30N2O6S — CID 145435638
(9R)-9-[2,2-dihydroxy-2-[(3-methoxythiophen-2-yl)methylamino]ethyl]-9-pyridin-2-yl-6-oxaspiro[4.5]decane-3,3-diol (PubChem CID 145435638) has the molecular formula C22H30N2O6S and a molecular weight of 450.56 g/mol. Its IUPAC name is (9R)-9-[2,2-dihydroxy-2-[(3-methoxythiophen-2-yl)methylamino]ethyl]-9-pyridin-2-yl-6-oxaspiro[4.5]decane-3,3-diol.
| Compound Name | (9R)-9-[2,2-dihydroxy-2-[(3-methoxythiophen-2-yl)methylamino]ethyl]-9-pyridin-2-yl-6-oxaspiro[4.5]decane-3,3-diol |
|---|---|
| PubChem CID | 145435638 |
| Molecular Formula | C22H30N2O6S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | (9R)-9-[2,2-dihydroxy-2-[(3-methoxythiophen-2-yl)methylamino]ethyl]-9-pyridin-2-yl-6-oxaspiro[4.5]decane-3,3-diol |
| SMILES | COc1ccsc1CNC(O)(O)C[C@@]1(c2ccccn2)CCOC2(CCC(O)(O)C2)C1 |
| InChI | InChI=1S/C22H30N2O6S/c1-29-16-5-11-31-17(16)12-24-22(27,28)14-19(18-4-2-3-9-23-18)8-10-30-20(13-19)6-7-21(25,26)15-20/h2-5,9,11,24-28H,6-8,10,12-15H2,1H3/t19-,20?/m1/s1 |
| InChIKey | XLSFMINTEZGJEO-FIWHBWSRSA-N |
| XLogP | 1.62 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|