C29H34N2O4S — CID 166671843
[(3-methoxythiophen-2-yl)methyl-[2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethyl]amino] benzoate (PubChem CID 166671843) has the molecular formula C29H34N2O4S and a molecular weight of 506.67 g/mol. Its IUPAC name is [(3-methoxythiophen-2-yl)methyl-[2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethyl]amino] benzoate.
| Compound Name | [(3-methoxythiophen-2-yl)methyl-[2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethyl]amino] benzoate |
|---|---|
| PubChem CID | 166671843 |
| Molecular Formula | C29H34N2O4S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | [(3-methoxythiophen-2-yl)methyl-[2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethyl]amino] benzoate |
| SMILES | COc1ccsc1CN(CC[C@@]1(c2ccccn2)CCOC2(CCCC2)C1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H34N2O4S/c1-33-24-12-20-36-25(24)21-31(35-27(32)23-9-3-2-4-10-23)18-15-28(26-11-5-8-17-30-26)16-19-34-29(22-28)13-6-7-14-29/h2-5,8-12,17,20H,6-7,13-16,18-19,21-22H2,1H3/t28-/m1/s1 |
| InChIKey | FDOIMVHCYBJCFL-MUUNZHRXSA-N |
| XLogP | 6.18 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|