C22H29N3O3S — CID 171390049
N-[(3-methoxythiophen-2-yl)methyl]-N-[2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethyl]nitrous amide (PubChem CID 171390049) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-[(3-methoxythiophen-2-yl)methyl]-N-[2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethyl]nitrous amide.
| Compound Name | N-[(3-methoxythiophen-2-yl)methyl]-N-[2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethyl]nitrous amide |
|---|---|
| PubChem CID | 171390049 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[(3-methoxythiophen-2-yl)methyl]-N-[2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethyl]nitrous amide |
| SMILES | COc1ccsc1CN(CC[C@@]1(c2ccccn2)CCOC2(CCCC2)C1)N=O |
| InChI | InChI=1S/C22H29N3O3S/c1-27-18-7-15-29-19(18)16-25(24-26)13-10-21(20-6-2-5-12-23-20)11-14-28-22(17-21)8-3-4-9-22/h2,5-7,12,15H,3-4,8-11,13-14,16-17H2,1H3/t21-/m1/s1 |
| InChIKey | GRZCAWMTIJQEMP-OAQYLSRUSA-N |
| XLogP | 5.09 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|