C23H31NO2S — CID 159649480
2-[(9R)-1,1,4,4,8,8,10,10-octadeuterio-9-[2,2,4,4-tetradeuterio-4-(3-methoxythiophen-2-yl)butyl]-6-oxaspiro[4.5]decan-9-yl]pyridine (PubChem CID 159649480) has the molecular formula C23H31NO2S and a molecular weight of 397.65 g/mol. Its IUPAC name is 2-[(9R)-1,1,4,4,8,8,10,10-octadeuterio-9-[2,2,4,4-tetradeuterio-4-(3-methoxythiophen-2-yl)butyl]-6-oxaspiro[4.5]decan-9-yl]pyridine.
| Compound Name | 2-[(9R)-1,1,4,4,8,8,10,10-octadeuterio-9-[2,2,4,4-tetradeuterio-4-(3-methoxythiophen-2-yl)butyl]-6-oxaspiro[4.5]decan-9-yl]pyridine |
|---|---|
| PubChem CID | 159649480 |
| Molecular Formula | C23H31NO2S |
| Molecular Weight | 397.65 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | 2-[(9R)-1,1,4,4,8,8,10,10-octadeuterio-9-[2,2,4,4-tetradeuterio-4-(3-methoxythiophen-2-yl)butyl]-6-oxaspiro[4.5]decan-9-yl]pyridine |
| SMILES | [2H]C([2H])(CC([2H])([2H])c1sccc1OC)C[C@@]1(c2ccccn2)C([2H])([2H])COC2(C([2H])([2H])CCC2([2H])[2H])C1([2H])[2H] |
| InChI | InChI=1S/C23H31NO2S/c1-25-19-10-17-27-20(19)8-2-4-11-22(21-9-3-7-15-24-21)14-16-26-23(18-22)12-5-6-13-23/h3,7,9-10,15,17H,2,4-6,8,11-14,16,18H2,1H3/t22-/m1/s1/i4D2,8D2,12D2,13D2,14D2,18D2 |
| InChIKey | XRMCFDAOUYUADE-JCAIQROZSA-N |
| XLogP | 5.93 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.65 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |