C28H37N3O2 — CID 145438790
4-N-(4-aminophenyl)-4-N-[4-[3-methyl-1-[(2-methylpropan-2-yl)oxy]pentan-3-yl]oxyphenyl]benzene-1,4-diamine (PubChem CID 145438790) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is 4-N-(4-aminophenyl)-4-N-[4-[3-methyl-1-[(2-methylpropan-2-yl)oxy]pentan-3-yl]oxyphenyl]benzene-1,4-diamine.
| Compound Name | 4-N-(4-aminophenyl)-4-N-[4-[3-methyl-1-[(2-methylpropan-2-yl)oxy]pentan-3-yl]oxyphenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 145438790 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | 4-N-(4-aminophenyl)-4-N-[4-[3-methyl-1-[(2-methylpropan-2-yl)oxy]pentan-3-yl]oxyphenyl]benzene-1,4-diamine |
| SMILES | CCC(C)(CCOC(C)(C)C)Oc1ccc(N(c2ccc(N)cc2)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C28H37N3O2/c1-6-28(5,19-20-32-27(2,3)4)33-26-17-15-25(16-18-26)31(23-11-7-21(29)8-12-23)24-13-9-22(30)10-14-24/h7-18H,6,19-20,29-30H2,1-5H3 |
| InChIKey | RXRNTIPPVSPSRK-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|