C15H24N2 — CID 145441524
ethane;[(2E,4Z)-hexa-2,4-dien-3-yl]-(4-methylcyclohexa-1,3-dien-1-yl)diazene (PubChem CID 145441524) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is ethane;[(2E,4Z)-hexa-2,4-dien-3-yl]-(4-methylcyclohexa-1,3-dien-1-yl)diazene.
| Compound Name | ethane;[(2E,4Z)-hexa-2,4-dien-3-yl]-(4-methylcyclohexa-1,3-dien-1-yl)diazene |
|---|---|
| PubChem CID | 145441524 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | ethane;[(2E,4Z)-hexa-2,4-dien-3-yl]-(4-methylcyclohexa-1,3-dien-1-yl)diazene |
| SMILES | C/C=C\C(=C/C)\N=N\C1=CC=C(C)CC1.CC |
| InChI | InChI=1S/C13H18N2.C2H6/c1-4-6-12(5-2)14-15-13-9-7-11(3)8-10-13;1-2/h4-7,9H,8,10H2,1-3H3;1-2H3/b6-4-,12-5+,15-14+; |
| InChIKey | CBZGGPAUZXXUSG-MEGNDXAZSA-N |
| XLogP | 5.57 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|