C20H24N2 — CID 138723760
[(3E,5Z,6Z)-5-but-3-en-2-ylidenenona-1,3,6,8-tetraen-4-yl]-[(3E,5Z)-hepta-1,3,5-trien-4-yl]diazene (PubChem CID 138723760) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is [(3E,5Z,6Z)-5-but-3-en-2-ylidenenona-1,3,6,8-tetraen-4-yl]-[(3E,5Z)-hepta-1,3,5-trien-4-yl]diazene.
| Compound Name | [(3E,5Z,6Z)-5-but-3-en-2-ylidenenona-1,3,6,8-tetraen-4-yl]-[(3E,5Z)-hepta-1,3,5-trien-4-yl]diazene |
|---|---|
| PubChem CID | 138723760 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | [(3E,5Z,6Z)-5-but-3-en-2-ylidenenona-1,3,6,8-tetraen-4-yl]-[(3E,5Z)-hepta-1,3,5-trien-4-yl]diazene |
| SMILES | C=C/C=C\C(=C(/C)C=C)C(=C/C=C)\N=N\C(\C=C/C)=C\C=C |
| InChI | InChI=1S/C20H24N2/c1-7-12-16-19(17(6)11-5)20(15-10-4)22-21-18(13-8-2)14-9-3/h7-16H,1-2,4-5H2,3,6H3/b14-9-,16-12-,18-13+,19-17-,20-15+,22-21+ |
| InChIKey | HHMQPUISBCLAEZ-QRHOFFQOSA-N |
| XLogP | 6.40 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|