C14H19F2N3O2 — CID 145443388
3-(6-cyano-2-ethyl-3,4-difluorophenyl)-1-methoxy-1-methylurea;ethane (PubChem CID 145443388) has the molecular formula C14H19F2N3O2 and a molecular weight of 299.32 g/mol. Its IUPAC name is 3-(6-cyano-2-ethyl-3,4-difluorophenyl)-1-methoxy-1-methylurea;ethane.
| Compound Name | 3-(6-cyano-2-ethyl-3,4-difluorophenyl)-1-methoxy-1-methylurea;ethane |
|---|---|
| PubChem CID | 145443388 |
| Molecular Formula | C14H19F2N3O2 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3-(6-cyano-2-ethyl-3,4-difluorophenyl)-1-methoxy-1-methylurea;ethane |
| SMILES | CC.CCc1c(F)c(F)cc(C#N)c1NC(=O)N(C)OC |
| InChI | InChI=1S/C12H13F2N3O2.C2H6/c1-4-8-10(14)9(13)5-7(6-15)11(8)16-12(18)17(2)19-3;1-2/h5H,4H2,1-3H3,(H,16,18);1-2H3 |
| InChIKey | HNFWJUDCGUVRGD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|