About 1-(2-methylpropoxy)propan-2-yl N-pyridin-3-ylcarbamate
1-(2-methylpropoxy)propan-2-yl N-pyridin-3-ylcarbamate (PubChem CID 145443911) has the molecular formula C13H20N2O3
and a molecular weight of 252.31 g/mol. Its IUPAC name is 1-(2-methylpropoxy)propan-2-yl N-pyridin-3-ylcarbamate.
Molecular Properties
| Compound Name | 1-(2-methylpropoxy)propan-2-yl N-pyridin-3-ylcarbamate |
| PubChem CID | 145443911 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1-(2-methylpropoxy)propan-2-yl N-pyridin-3-ylcarbamate |
| SMILES | CC(C)COCC(C)OC(=O)Nc1cccnc1 |
| InChI | InChI=1S/C13H20N2O3/c1-10(2)8-17-9-11(3)18-13(16)15-12-5-4-6-14-7-12/h4-7,10-11H,8-9H2,1-3H3,(H,15,16) |
| InChIKey | JEGKNHRMXVUVNF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-methylpropoxy)propan-2-yl N-pyridin-3-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylpropoxy)propan-2-yl N-pyridin-3-ylcarbamate?
The IUPAC name of 1-(2-methylpropoxy)propan-2-yl N-pyridin-3-ylcarbamate (CID 145443911) is 1-(2-methylpropoxy)propan-2-yl N-pyridin-3-ylcarbamate.
What is the SMILES notation for 1-(2-methylpropoxy)propan-2-yl N-pyridin-3-ylcarbamate?
The canonical SMILES for 1-(2-methylpropoxy)propan-2-yl N-pyridin-3-ylcarbamate is CC(C)COCC(C)OC(=O)Nc1cccnc1.
What is the InChIKey of 1-(2-methylpropoxy)propan-2-yl N-pyridin-3-ylcarbamate?
The InChIKey is JEGKNHRMXVUVNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O3/c1-10(2)8-17-9-11(3)18-13(16)15-12-5-4-6-14-7-12/h4-7,10-11H,8-9H2,1-3H3,(H,15,16).
What are the key properties of 1-(2-methylpropoxy)propan-2-yl N-pyridin-3-ylcarbamate?
1-(2-methylpropoxy)propan-2-yl N-pyridin-3-ylcarbamate has a molecular weight of 252.31 g/mol, XLogP of 2.69, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylpropoxy)propan-2-yl N-pyridin-3-ylcarbamate is sourced from PubChem (CID 145443911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).