C30H38N4O4 — CID 145446651
4-[(Z)-2-carbamoyl-4-iminopent-2-enyl]-N-[2-[(3S)-5-(2-hydroxypropan-2-yl)-3-methyl-2-phenylpyrrolidin-1-yl]-2-oxoethyl]-3-methylbenzamide (PubChem CID 145446651) has the molecular formula C30H38N4O4 and a molecular weight of 518.66 g/mol. Its IUPAC name is 4-[(Z)-2-carbamoyl-4-iminopent-2-enyl]-N-[2-[(3S)-5-(2-hydroxypropan-2-yl)-3-methyl-2-phenylpyrrolidin-1-yl]-2-oxoethyl]-3-methylbenzamide.
| Compound Name | 4-[(Z)-2-carbamoyl-4-iminopent-2-enyl]-N-[2-[(3S)-5-(2-hydroxypropan-2-yl)-3-methyl-2-phenylpyrrolidin-1-yl]-2-oxoethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 145446651 |
| Molecular Formula | C30H38N4O4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 4-[(Z)-2-carbamoyl-4-iminopent-2-enyl]-N-[2-[(3S)-5-(2-hydroxypropan-2-yl)-3-methyl-2-phenylpyrrolidin-1-yl]-2-oxoethyl]-3-methylbenzamide |
| SMILES | [H]/N=C(C)/C=C(/Cc1ccc(C(=O)NCC(=O)N2C(c3ccccc3)[C@@H](C)CC2C(C)(C)O)cc1C)C(N)=O |
| InChI | InChI=1S/C30H38N4O4/c1-18-13-23(12-11-22(18)16-24(28(32)36)15-20(3)31)29(37)33-17-26(35)34-25(30(4,5)38)14-19(2)27(34)21-9-7-6-8-10-21/h6-13,15,19,25,27,31,38H,14,16-17H2,1-5H3,(H2,32,36)(H,33,37)/b24-15-,31-20+/t19-,25?,27?/m0/s1 |
| InChIKey | KGXNTBOBSIVCRM-IOQVMJRWSA-N |
| XLogP | 3.47 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|