C27H29N5O3 — CID 145446685
4-[(Z)-2-carbamoyl-4-iminopent-2-enyl]-N-[2-(2-cyano-5-phenylpyrrolidin-1-yl)-2-oxoethyl]-3-methylbenzamide (PubChem CID 145446685) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is 4-[(Z)-2-carbamoyl-4-iminopent-2-enyl]-N-[2-(2-cyano-5-phenylpyrrolidin-1-yl)-2-oxoethyl]-3-methylbenzamide.
| Compound Name | 4-[(Z)-2-carbamoyl-4-iminopent-2-enyl]-N-[2-(2-cyano-5-phenylpyrrolidin-1-yl)-2-oxoethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 145446685 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 4-[(Z)-2-carbamoyl-4-iminopent-2-enyl]-N-[2-(2-cyano-5-phenylpyrrolidin-1-yl)-2-oxoethyl]-3-methylbenzamide |
| SMILES | [H]/N=C(C)/C=C(/Cc1ccc(C(=O)NCC(=O)N2C(C#N)CCC2c2ccccc2)cc1C)C(N)=O |
| InChI | InChI=1S/C27H29N5O3/c1-17-12-21(9-8-20(17)14-22(26(30)34)13-18(2)29)27(35)31-16-25(33)32-23(15-28)10-11-24(32)19-6-4-3-5-7-19/h3-9,12-13,23-24,29H,10-11,14,16H2,1-2H3,(H2,30,34)(H,31,35)/b22-13-,29-18+ |
| InChIKey | XQYAKQKUVGRQPY-PDTULWBSSA-N |
| XLogP | 2.97 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|