C32H42ClN5O4 — CID 145446707
2-[5-(3-chlorophenyl)-1-formylpyrrolidin-2-yl]-2-methylpropanenitrile;4-[(E)-4-imino-1-oxopent-2-en-2-yl]oxy-3-methyl-N-propan-2-ylbenzamide;methanamine (PubChem CID 145446707) has the molecular formula C32H42ClN5O4 and a molecular weight of 596.17 g/mol. Its IUPAC name is 2-[5-(3-chlorophenyl)-1-formylpyrrolidin-2-yl]-2-methylpropanenitrile;4-[(E)-4-imino-1-oxopent-2-en-2-yl]oxy-3-methyl-N-propan-2-ylbenzamide;methanamine.
| Compound Name | 2-[5-(3-chlorophenyl)-1-formylpyrrolidin-2-yl]-2-methylpropanenitrile;4-[(E)-4-imino-1-oxopent-2-en-2-yl]oxy-3-methyl-N-propan-2-ylbenzamide;methanamine |
|---|---|
| PubChem CID | 145446707 |
| Molecular Formula | C32H42ClN5O4 |
| Molecular Weight | 596.17 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | 2-[5-(3-chlorophenyl)-1-formylpyrrolidin-2-yl]-2-methylpropanenitrile;4-[(E)-4-imino-1-oxopent-2-en-2-yl]oxy-3-methyl-N-propan-2-ylbenzamide;methanamine |
| SMILES | CC(C)(C#N)C1CCC(c2cccc(Cl)c2)N1C=O.CN.[H]/N=C(C)/C=C(\C=O)Oc1ccc(C(=O)NC(C)C)cc1C |
| InChI | InChI=1S/C16H20N2O3.C15H17ClN2O.CH5N/c1-10(2)18-16(20)13-5-6-15(11(3)7-13)21-14(9-19)8-12(4)17;1-15(2,9-17)14-7-6-13(18(14)10-19)11-4-3-5-12(16)8-11;1-2/h5-10,17H,1-4H3,(H,18,20);3-5,8,10,13-14H,6-7H2,1-2H3;2H2,1H3/b14-8+,17-12+;; |
| InChIKey | KKFWPUOYLQDGML-YGUYHCJISA-N |
| XLogP | 5.76 |
| TPSA | 149.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.17 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|