C15H19FN2 — CID 145448857
5-cyclopropyl-3-(4-fluorophenyl)-4-methyl-1H-pyrazole;ethane (PubChem CID 145448857) has the molecular formula C15H19FN2 and a molecular weight of 246.33 g/mol. Its IUPAC name is 5-cyclopropyl-3-(4-fluorophenyl)-4-methyl-1H-pyrazole;ethane.
| Compound Name | 5-cyclopropyl-3-(4-fluorophenyl)-4-methyl-1H-pyrazole;ethane |
|---|---|
| PubChem CID | 145448857 |
| Molecular Formula | C15H19FN2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 5-cyclopropyl-3-(4-fluorophenyl)-4-methyl-1H-pyrazole;ethane |
| SMILES | CC.Cc1c(-c2ccc(F)cc2)n[nH]c1C1CC1 |
| InChI | InChI=1S/C13H13FN2.C2H6/c1-8-12(9-2-3-9)15-16-13(8)10-4-6-11(14)7-5-10;1-2/h4-7,9H,2-3H2,1H3,(H,15,16);1-2H3 |
| InChIKey | ZWXJPFGQUMUPRU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |