C20H16F2O4S — CID 145453071
(1R,3aS,9bR)-3a-(benzenesulfonyl)-1-(difluoromethyl)-2-methylidene-3,9b-dihydro-1H-cyclopenta[c]chromen-4-one (PubChem CID 145453071) has the molecular formula C20H16F2O4S and a molecular weight of 390.41 g/mol. Its IUPAC name is (1R,3aS,9bR)-3a-(benzenesulfonyl)-1-(difluoromethyl)-2-methylidene-3,9b-dihydro-1H-cyclopenta[c]chromen-4-one.
| Compound Name | (1R,3aS,9bR)-3a-(benzenesulfonyl)-1-(difluoromethyl)-2-methylidene-3,9b-dihydro-1H-cyclopenta[c]chromen-4-one |
|---|---|
| PubChem CID | 145453071 |
| Molecular Formula | C20H16F2O4S |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | (1R,3aS,9bR)-3a-(benzenesulfonyl)-1-(difluoromethyl)-2-methylidene-3,9b-dihydro-1H-cyclopenta[c]chromen-4-one |
| SMILES | C=C1C[C@@]2(S(=O)(=O)c3ccccc3)C(=O)Oc3ccccc3[C@H]2[C@H]1C(F)F |
| InChI | InChI=1S/C20H16F2O4S/c1-12-11-20(27(24,25)13-7-3-2-4-8-13)17(16(12)18(21)22)14-9-5-6-10-15(14)26-19(20)23/h2-10,16-18H,1,11H2/t16-,17-,20-/m0/s1 |
| InChIKey | LMDPVNRJQWHLKK-ZWOKBUDYSA-N |
| XLogP | 3.74 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|