C25H17F3O4S — CID 145453117
(1R,3aS,9bR)-3a-(benzenesulfonyl)-2-methylidene-1-(2,4,6-trifluorophenyl)-3,9b-dihydro-1H-cyclopenta[c]chromen-4-one (PubChem CID 145453117) has the molecular formula C25H17F3O4S and a molecular weight of 470.47 g/mol. Its IUPAC name is (1R,3aS,9bR)-3a-(benzenesulfonyl)-2-methylidene-1-(2,4,6-trifluorophenyl)-3,9b-dihydro-1H-cyclopenta[c]chromen-4-one.
| Compound Name | (1R,3aS,9bR)-3a-(benzenesulfonyl)-2-methylidene-1-(2,4,6-trifluorophenyl)-3,9b-dihydro-1H-cyclopenta[c]chromen-4-one |
|---|---|
| PubChem CID | 145453117 |
| Molecular Formula | C25H17F3O4S |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | (1R,3aS,9bR)-3a-(benzenesulfonyl)-2-methylidene-1-(2,4,6-trifluorophenyl)-3,9b-dihydro-1H-cyclopenta[c]chromen-4-one |
| SMILES | C=C1C[C@@]2(S(=O)(=O)c3ccccc3)C(=O)Oc3ccccc3[C@H]2[C@H]1c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C25H17F3O4S/c1-14-13-25(33(30,31)16-7-3-2-4-8-16)23(17-9-5-6-10-20(17)32-24(25)29)21(14)22-18(27)11-15(26)12-19(22)28/h2-12,21,23H,1,13H2/t21-,23+,25+/m1/s1 |
| InChIKey | XTPGLWPZANLHRQ-VTZPFEBOSA-N |
| XLogP | 5.06 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|