C18H11F9O4S — CID 10553239
(1S,2S,11R,12R)-11-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-9-oxatetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7,13-tetraen-10-one (PubChem CID 10553239) has the molecular formula C18H11F9O4S and a molecular weight of 494.33 g/mol. Its IUPAC name is (1S,2S,11R,12R)-11-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-9-oxatetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7,13-tetraen-10-one.
| Compound Name | (1S,2S,11R,12R)-11-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-9-oxatetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7,13-tetraen-10-one |
|---|---|
| PubChem CID | 10553239 |
| Molecular Formula | C18H11F9O4S |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | (1S,2S,11R,12R)-11-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-9-oxatetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7,13-tetraen-10-one |
| SMILES | O=C1Oc2ccccc2[C@@H]2[C@@H]3C=C[C@@H](C3)[C@]12S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H11F9O4S/c19-15(20,17(23,24)25)16(21,22)18(26,27)32(29,30)14-9-6-5-8(7-9)12(14)10-3-1-2-4-11(10)31-13(14)28/h1-6,8-9,12H,7H2/t8-,9+,12+,14-/m1/s1 |
| InChIKey | DURZSOPGVVFLQK-VILIVFPASA-N |
| XLogP | 4.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|