C20H22O2S — CID 15472391
(1S,3S,12R,16R)-16,19,19-trimethyl-10-oxa-14-thiapentacyclo[14.2.1.02,15.03,12.04,9]nonadeca-2(15),4,6,8-tetraen-11-one (PubChem CID 15472391) has the molecular formula C20H22O2S and a molecular weight of 326.46 g/mol. Its IUPAC name is (1S,3S,12R,16R)-16,19,19-trimethyl-10-oxa-14-thiapentacyclo[14.2.1.02,15.03,12.04,9]nonadeca-2(15),4,6,8-tetraen-11-one.
| Compound Name | (1S,3S,12R,16R)-16,19,19-trimethyl-10-oxa-14-thiapentacyclo[14.2.1.02,15.03,12.04,9]nonadeca-2(15),4,6,8-tetraen-11-one |
|---|---|
| PubChem CID | 15472391 |
| Molecular Formula | C20H22O2S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (1S,3S,12R,16R)-16,19,19-trimethyl-10-oxa-14-thiapentacyclo[14.2.1.02,15.03,12.04,9]nonadeca-2(15),4,6,8-tetraen-11-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)C1=C2[C@@H]2c3ccccc3OC(=O)[C@@H]2CS1 |
| InChI | InChI=1S/C20H22O2S/c1-19(2)13-8-9-20(19,3)17-16(13)15-11-6-4-5-7-14(11)22-18(21)12(15)10-23-17/h4-7,12-13,15H,8-10H2,1-3H3/t12-,13-,15-,20+/m1/s1 |
| InChIKey | PDGCVHKSDNHPHM-VHTZSSMTSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|