C18H26O3S — CID 134957040
[2-(1-heptylsulfanyl-1-oxopropan-2-yl)phenyl] acetate (PubChem CID 134957040) has the molecular formula C18H26O3S and a molecular weight of 322.47 g/mol. Its IUPAC name is [2-(1-heptylsulfanyl-1-oxopropan-2-yl)phenyl] acetate.
| Compound Name | [2-(1-heptylsulfanyl-1-oxopropan-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 134957040 |
| Molecular Formula | C18H26O3S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | [2-(1-heptylsulfanyl-1-oxopropan-2-yl)phenyl] acetate |
| SMILES | CCCCCCCSC(=O)C(C)c1ccccc1OC(C)=O |
| InChI | InChI=1S/C18H26O3S/c1-4-5-6-7-10-13-22-18(20)14(2)16-11-8-9-12-17(16)21-15(3)19/h8-9,11-12,14H,4-7,10,13H2,1-3H3 |
| InChIKey | DZSVWURWCAUXGF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|