C25H15F5O4S — CID 145453106
(1R,3aS,9bR)-3a-(benzenesulfonyl)-2-methylidene-1-(2,3,4,5,6-pentafluorophenyl)-3,9b-dihydro-1H-cyclopenta[c]chromen-4-one (PubChem CID 145453106) has the molecular formula C25H15F5O4S and a molecular weight of 506.45 g/mol. Its IUPAC name is (1R,3aS,9bR)-3a-(benzenesulfonyl)-2-methylidene-1-(2,3,4,5,6-pentafluorophenyl)-3,9b-dihydro-1H-cyclopenta[c]chromen-4-one.
| Compound Name | (1R,3aS,9bR)-3a-(benzenesulfonyl)-2-methylidene-1-(2,3,4,5,6-pentafluorophenyl)-3,9b-dihydro-1H-cyclopenta[c]chromen-4-one |
|---|---|
| PubChem CID | 145453106 |
| Molecular Formula | C25H15F5O4S |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | (1R,3aS,9bR)-3a-(benzenesulfonyl)-2-methylidene-1-(2,3,4,5,6-pentafluorophenyl)-3,9b-dihydro-1H-cyclopenta[c]chromen-4-one |
| SMILES | C=C1C[C@@]2(S(=O)(=O)c3ccccc3)C(=O)Oc3ccccc3[C@H]2[C@H]1c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25H15F5O4S/c1-12-11-25(35(32,33)13-7-3-2-4-8-13)18(14-9-5-6-10-15(14)34-24(25)31)16(12)17-19(26)21(28)23(30)22(29)20(17)27/h2-10,16,18H,1,11H2/t16-,18+,25+/m1/s1 |
| InChIKey | FWGSYKSPOBVYGX-QDKQFYOWSA-N |
| XLogP | 5.34 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|