C18H16F3NO2S — CID 145453127
benzyl (2R,3S)-4-methylidene-2-thiophen-2-yl-3-(trifluoromethyl)pyrrolidine-1-carboxylate (PubChem CID 145453127) has the molecular formula C18H16F3NO2S and a molecular weight of 367.39 g/mol. Its IUPAC name is benzyl (2R,3S)-4-methylidene-2-thiophen-2-yl-3-(trifluoromethyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3S)-4-methylidene-2-thiophen-2-yl-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 145453127 |
| Molecular Formula | C18H16F3NO2S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | benzyl (2R,3S)-4-methylidene-2-thiophen-2-yl-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
| SMILES | C=C1CN(C(=O)OCc2ccccc2)[C@@H](c2cccs2)[C@H]1C(F)(F)F |
| InChI | InChI=1S/C18H16F3NO2S/c1-12-10-22(17(23)24-11-13-6-3-2-4-7-13)16(14-8-5-9-25-14)15(12)18(19,20)21/h2-9,15-16H,1,10-11H2/t15-,16-/m0/s1 |
| InChIKey | UBGYYKUGGGKPCN-HOTGVXAUSA-N |
| XLogP | 5.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|