C26H27N3O — CID 145459854
2-amino-5-[3-(benzylamino)phenyl]-5-phenyl-3-propyl-3H-pyrrol-4-one (PubChem CID 145459854) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-amino-5-[3-(benzylamino)phenyl]-5-phenyl-3-propyl-3H-pyrrol-4-one.
| Compound Name | 2-amino-5-[3-(benzylamino)phenyl]-5-phenyl-3-propyl-3H-pyrrol-4-one |
|---|---|
| PubChem CID | 145459854 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 2-amino-5-[3-(benzylamino)phenyl]-5-phenyl-3-propyl-3H-pyrrol-4-one |
| SMILES | CCCC1C(=O)C(c2ccccc2)(c2cccc(NCc3ccccc3)c2)N=C1N |
| InChI | InChI=1S/C26H27N3O/c1-2-10-23-24(30)26(29-25(23)27,20-13-7-4-8-14-20)21-15-9-16-22(17-21)28-18-19-11-5-3-6-12-19/h3-9,11-17,23,28H,2,10,18H2,1H3,(H2,27,29) |
| InChIKey | CYPLCYIDWHDLOO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |