C25H28N4O3 — CID 145460884
2-amino-N-[4-[(3-hydroxyphenyl)carbamoylamino]butyl]-2,2-diphenylacetamide (PubChem CID 145460884) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-amino-N-[4-[(3-hydroxyphenyl)carbamoylamino]butyl]-2,2-diphenylacetamide.
| Compound Name | 2-amino-N-[4-[(3-hydroxyphenyl)carbamoylamino]butyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 145460884 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 2-amino-N-[4-[(3-hydroxyphenyl)carbamoylamino]butyl]-2,2-diphenylacetamide |
| SMILES | NC(C(=O)NCCCCNC(=O)Nc1cccc(O)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28N4O3/c26-25(19-10-3-1-4-11-19,20-12-5-2-6-13-20)23(31)27-16-7-8-17-28-24(32)29-21-14-9-15-22(30)18-21/h1-6,9-15,18,30H,7-8,16-17,26H2,(H,27,31)(H2,28,29,32) |
| InChIKey | JWIJIIOOJXCHOM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|