C18H19NS — CID 145460952
1-(methylamino)-1,1-diphenylpent-4-ene-2-thione (PubChem CID 145460952) has the molecular formula C18H19NS and a molecular weight of 281.42 g/mol. Its IUPAC name is 1-(methylamino)-1,1-diphenylpent-4-ene-2-thione.
| Compound Name | 1-(methylamino)-1,1-diphenylpent-4-ene-2-thione |
|---|---|
| PubChem CID | 145460952 |
| Molecular Formula | C18H19NS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-(methylamino)-1,1-diphenylpent-4-ene-2-thione |
| SMILES | C=CCC(=S)C(NC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NS/c1-3-10-17(20)18(19-2,15-11-6-4-7-12-15)16-13-8-5-9-14-16/h3-9,11-14,19H,1,10H2,2H3 |
| InChIKey | LPBVMNNFQBPQLI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|