C27H26N4OS — CID 14546173
N-[(E)-benzylideneamino]-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-3-methylbutanamide (PubChem CID 14546173) has the molecular formula C27H26N4OS and a molecular weight of 454.60 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-3-methylbutanamide.
| Compound Name | N-[(E)-benzylideneamino]-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 14546173 |
| Molecular Formula | C27H26N4OS |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N-[(E)-benzylideneamino]-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-3-methylbutanamide |
| SMILES | CC(C)C(Sc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)C(=O)N/N=C/c1ccccc1 |
| InChI | InChI=1S/C27H26N4OS/c1-19(2)25(26(32)31-28-18-20-12-6-3-7-13-20)33-27-29-23(21-14-8-4-9-15-21)24(30-27)22-16-10-5-11-17-22/h3-19,25H,1-2H3,(H,29,30)(H,31,32)/b28-18+ |
| InChIKey | ZYUJKSSVZWQTQV-MTDXEUNCSA-N |
| XLogP | 6.01 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|