C34H46N2 — CID 145461780
3-[[[3-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]phenyl]-3-methylbut-1-en-2-yl]-prop-1-en-2-ylamino]methyl]-N-methyl-N-pentylaniline (PubChem CID 145461780) has the molecular formula C34H46N2 and a molecular weight of 482.76 g/mol. Its IUPAC name is 3-[[[3-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]phenyl]-3-methylbut-1-en-2-yl]-prop-1-en-2-ylamino]methyl]-N-methyl-N-pentylaniline.
| Compound Name | 3-[[[3-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]phenyl]-3-methylbut-1-en-2-yl]-prop-1-en-2-ylamino]methyl]-N-methyl-N-pentylaniline |
|---|---|
| PubChem CID | 145461780 |
| Molecular Formula | C34H46N2 |
| Molecular Weight | 482.76 g/mol |
| Exact Mass | 482.37 |
| IUPAC Name | 3-[[[3-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]phenyl]-3-methylbut-1-en-2-yl]-prop-1-en-2-ylamino]methyl]-N-methyl-N-pentylaniline |
| SMILES | C=C/C=C\C(=C/C)c1cccc(C(C)(C)C(=C)N(Cc2cccc(N(C)CCCCC)c2)C(=C)C)c1 |
| InChI | InChI=1S/C34H46N2/c1-10-13-15-23-35(9)33-22-16-18-29(24-33)26-36(27(4)5)28(6)34(7,8)32-21-17-20-31(25-32)30(12-3)19-14-11-2/h11-12,14,16-22,24-25H,2,4,6,10,13,15,23,26H2,1,3,5,7-9H3/b19-14-,30-12+ |
| InChIKey | VHPKDVMPMAIECN-HSNQBBTQSA-N |
| XLogP | 9.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.76 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|