C20H15NO4 — CID 14546186
2-[(3-methyl-5-oxo-4H-1,2-oxazol-4-yl)-phenylmethyl]indene-1,3-dione (PubChem CID 14546186) has the molecular formula C20H15NO4 and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-[(3-methyl-5-oxo-4H-1,2-oxazol-4-yl)-phenylmethyl]indene-1,3-dione.
| Compound Name | 2-[(3-methyl-5-oxo-4H-1,2-oxazol-4-yl)-phenylmethyl]indene-1,3-dione |
|---|---|
| PubChem CID | 14546186 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-[(3-methyl-5-oxo-4H-1,2-oxazol-4-yl)-phenylmethyl]indene-1,3-dione |
| SMILES | CC1=NOC(=O)C1C(c1ccccc1)C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H15NO4/c1-11-15(20(24)25-21-11)16(12-7-3-2-4-8-12)17-18(22)13-9-5-6-10-14(13)19(17)23/h2-10,15-17H,1H3 |
| InChIKey | YAZPBUNKQHDGKV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|