C25H25ClN2O3S — CID 145463648
CID 145463648 (PubChem CID 145463648) has the molecular formula C25H25ClN2O3S and a molecular weight of 469.01 g/mol.
| Compound Name | CID 145463648 |
|---|---|
| PubChem CID | 145463648 |
| Molecular Formula | C25H25ClN2O3S |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | — |
| SMILES | [O+]#[S-](NC(CO)Cc1c[nH]c2ccccc12)C1=CC(c2ccc(Cl)cc2)CC2=C1OCC2 |
| InChI | InChI=1S/C25H25ClN2O3S/c26-20-7-5-16(6-8-20)18-11-17-9-10-31-25(17)24(13-18)32(30)28-21(15-29)12-19-14-27-23-4-2-1-3-22(19)23/h1-8,13-14,18,21,27-29H,9-12,15H2 |
| InChIKey | FKCRXMBEPKXKIN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 77.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|