C27H25NO3 — CID 145465271
1-[2-[4-[4-(3-hydroxypropyl)phenyl]phenyl]-6-methoxyquinolin-4-yl]ethanone (PubChem CID 145465271) has the molecular formula C27H25NO3 and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-[2-[4-[4-(3-hydroxypropyl)phenyl]phenyl]-6-methoxyquinolin-4-yl]ethanone.
| Compound Name | 1-[2-[4-[4-(3-hydroxypropyl)phenyl]phenyl]-6-methoxyquinolin-4-yl]ethanone |
|---|---|
| PubChem CID | 145465271 |
| Molecular Formula | C27H25NO3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-[2-[4-[4-(3-hydroxypropyl)phenyl]phenyl]-6-methoxyquinolin-4-yl]ethanone |
| SMILES | COc1ccc2nc(-c3ccc(-c4ccc(CCCO)cc4)cc3)cc(C(C)=O)c2c1 |
| InChI | InChI=1S/C27H25NO3/c1-18(30)24-17-27(28-26-14-13-23(31-2)16-25(24)26)22-11-9-21(10-12-22)20-7-5-19(6-8-20)4-3-15-29/h5-14,16-17,29H,3-4,15H2,1-2H3 |
| InChIKey | SLNNPAJYMIDOIS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |