C25H25N3O3 — CID 145465474
N-hydroxy-2-[4-[4-(3-hydroxypropyl)phenyl]phenyl]-5-methyl-8,8a-dihydro-1,6-naphthyridine-4-carboxamide (PubChem CID 145465474) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-hydroxy-2-[4-[4-(3-hydroxypropyl)phenyl]phenyl]-5-methyl-8,8a-dihydro-1,6-naphthyridine-4-carboxamide.
| Compound Name | N-hydroxy-2-[4-[4-(3-hydroxypropyl)phenyl]phenyl]-5-methyl-8,8a-dihydro-1,6-naphthyridine-4-carboxamide |
|---|---|
| PubChem CID | 145465474 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-hydroxy-2-[4-[4-(3-hydroxypropyl)phenyl]phenyl]-5-methyl-8,8a-dihydro-1,6-naphthyridine-4-carboxamide |
| SMILES | CC1=C2C(C(=O)NO)=CC(c3ccc(-c4ccc(CCCO)cc4)cc3)=NC2CC=N1 |
| InChI | InChI=1S/C25H25N3O3/c1-16-24-21(25(30)28-31)15-23(27-22(24)12-13-26-16)20-10-8-19(9-11-20)18-6-4-17(5-7-18)3-2-14-29/h4-11,13,15,22,29,31H,2-3,12,14H2,1H3,(H,28,30) |
| InChIKey | GKANMBVJZIVOAJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|