C29H35N3O3 — CID 145464863
3-[4-[4-(4,5-dimethyl-1,6-naphthyridin-2-yl)phenyl]phenyl]propan-1-ol;ethane;N-hydroxyacetamide (PubChem CID 145464863) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is 3-[4-[4-(4,5-dimethyl-1,6-naphthyridin-2-yl)phenyl]phenyl]propan-1-ol;ethane;N-hydroxyacetamide.
| Compound Name | 3-[4-[4-(4,5-dimethyl-1,6-naphthyridin-2-yl)phenyl]phenyl]propan-1-ol;ethane;N-hydroxyacetamide |
|---|---|
| PubChem CID | 145464863 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 3-[4-[4-(4,5-dimethyl-1,6-naphthyridin-2-yl)phenyl]phenyl]propan-1-ol;ethane;N-hydroxyacetamide |
| SMILES | CC.CC(=O)NO.Cc1cc(-c2ccc(-c3ccc(CCCO)cc3)cc2)nc2ccnc(C)c12 |
| InChI | InChI=1S/C25H24N2O.C2H5NO2.C2H6/c1-17-16-24(27-23-13-14-26-18(2)25(17)23)22-11-9-21(10-12-22)20-7-5-19(6-8-20)4-3-15-28;1-2(4)3-5;1-2/h5-14,16,28H,3-4,15H2,1-2H3;5H,1H3,(H,3,4);1-2H3 |
| InChIKey | OLZPLZSFDXTBGB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|