C28H29N3O5 — CID 145465481
N-hydroxy-7-[2-(2-hydroxyethoxy)ethyl]-2-[4-[4-(3-hydroxypropyl)phenyl]phenyl]-1,6-naphthyridine-4-carboxamide (PubChem CID 145465481) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is N-hydroxy-7-[2-(2-hydroxyethoxy)ethyl]-2-[4-[4-(3-hydroxypropyl)phenyl]phenyl]-1,6-naphthyridine-4-carboxamide.
| Compound Name | N-hydroxy-7-[2-(2-hydroxyethoxy)ethyl]-2-[4-[4-(3-hydroxypropyl)phenyl]phenyl]-1,6-naphthyridine-4-carboxamide |
|---|---|
| PubChem CID | 145465481 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | N-hydroxy-7-[2-(2-hydroxyethoxy)ethyl]-2-[4-[4-(3-hydroxypropyl)phenyl]phenyl]-1,6-naphthyridine-4-carboxamide |
| SMILES | O=C(NO)c1cc(-c2ccc(-c3ccc(CCCO)cc3)cc2)nc2cc(CCOCCO)ncc12 |
| InChI | InChI=1S/C28H29N3O5/c32-12-1-2-19-3-5-20(6-4-19)21-7-9-22(10-8-21)26-17-24(28(34)31-35)25-18-29-23(16-27(25)30-26)11-14-36-15-13-33/h3-10,16-18,32-33,35H,1-2,11-15H2,(H,31,34) |
| InChIKey | ZXVCKCCCUOCDON-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|