C10H20N2 — CID 145467090
2-ethenyl-N,N-dimethyl-4-methyliminopentan-1-amine (PubChem CID 145467090) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 2-ethenyl-N,N-dimethyl-4-methyliminopentan-1-amine.
| Compound Name | 2-ethenyl-N,N-dimethyl-4-methyliminopentan-1-amine |
|---|---|
| PubChem CID | 145467090 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 2-ethenyl-N,N-dimethyl-4-methyliminopentan-1-amine |
| SMILES | C=CC(C/C(C)=N/C)CN(C)C |
| InChI | InChI=1S/C10H20N2/c1-6-10(8-12(4)5)7-9(2)11-3/h6,10H,1,7-8H2,2-5H3/b11-9+ |
| InChIKey | CJROYQKHJXHHKO-PKNBQFBNSA-N |
| XLogP | 1.83 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|