C14H28N2 — CID 143316732
N,N-diethyl-2,6-dimethyl-4-methyliminohept-5-en-1-amine (PubChem CID 143316732) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is N,N-diethyl-2,6-dimethyl-4-methyliminohept-5-en-1-amine.
| Compound Name | N,N-diethyl-2,6-dimethyl-4-methyliminohept-5-en-1-amine |
|---|---|
| PubChem CID | 143316732 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | N,N-diethyl-2,6-dimethyl-4-methyliminohept-5-en-1-amine |
| SMILES | CCN(CC)CC(C)C/C(C=C(C)C)=N/C |
| InChI | InChI=1S/C14H28N2/c1-7-16(8-2)11-13(5)10-14(15-6)9-12(3)4/h9,13H,7-8,10-11H2,1-6H3/b15-14+ |
| InChIKey | RWSRUYKZLQYLIR-CCEZHUSRSA-N |
| XLogP | 3.39 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|