C7H13F2N — CID 145467910
N-ethyl-4,4-difluoro-3-methylbut-3-en-1-amine (PubChem CID 145467910) has the molecular formula C7H13F2N and a molecular weight of 149.18 g/mol. Its IUPAC name is N-ethyl-4,4-difluoro-3-methylbut-3-en-1-amine.
| Compound Name | N-ethyl-4,4-difluoro-3-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 145467910 |
| Molecular Formula | C7H13F2N |
| Molecular Weight | 149.18 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | N-ethyl-4,4-difluoro-3-methylbut-3-en-1-amine |
| SMILES | CCNCCC(C)=C(F)F |
| InChI | InChI=1S/C7H13F2N/c1-3-10-5-4-6(2)7(8)9/h10H,3-5H2,1-2H3 |
| InChIKey | MRKUQPPWNYNVBZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|