C10H16F2 — CID 58962882
1,1-difluoro-2-methyl-5-methylideneoct-1-ene (PubChem CID 58962882) has the molecular formula C10H16F2 and a molecular weight of 174.23 g/mol. Its IUPAC name is 1,1-difluoro-2-methyl-5-methylideneoct-1-ene.
| Compound Name | 1,1-difluoro-2-methyl-5-methylideneoct-1-ene |
|---|---|
| PubChem CID | 58962882 |
| Molecular Formula | C10H16F2 |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1,1-difluoro-2-methyl-5-methylideneoct-1-ene |
| SMILES | C=C(CCC)CCC(C)=C(F)F |
| InChI | InChI=1S/C10H16F2/c1-4-5-8(2)6-7-9(3)10(11)12/h2,4-7H2,1,3H3 |
| InChIKey | FNTAWDUHWHLLQD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|